1,2-O-Isopropylidene-5-O-trityl-α-D-xylofuranose structure
|
Common Name | 1,2-O-Isopropylidene-5-O-trityl-α-D-xylofuranose | ||
|---|---|---|---|---|
| CAS Number | 20590-53-8 | Molecular Weight | 432.508 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 562.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C27H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.2±28.7 °C | |
| Name | 1,2-O-ISOPROPYLIDENE-5-O-TRIPHENYLMETHYL-α-D-XYLOFURANOSIDE |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 562.9±45.0 °C at 760 mmHg |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.508 |
| Flash Point | 294.2±28.7 °C |
| Exact Mass | 432.193665 |
| PSA | 57.15000 |
| LogP | 7.09 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | NRPUJUCGRNWUOE-ZFFYZDHPSA-N |
| SMILES | CC1(C)OC2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(O)C2O1 |
|
~95%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Carbohydrate Research, , vol. 346, # 17 p. 2801 - 2804 |
|
~98%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Chemistry - A European Journal, , vol. 13, # 16 p. 4510 - 4522 |
|
~91%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Synlett, , # 10 p. 1479 - 1481 |
|
~80%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Synthetic Communications, , vol. 37, # 12 p. 2091 - 2101 |
|
~%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Synlett, , # 10 p. 1479 - 1481 |
|
~%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 2 p. 490 - 491 |
|
~%
1,2-O-Isopropyl... CAS#:20590-53-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 2 p. 490 - 491 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| 1,2-Di-O-methyl-myo-mositol |
| Viscumitol |
| 1,2-Di-O-methyl-muco-inositol |
| 1,2-O-Isopropylidene-5-O-trityl-α-D-xylofuranose |
| α-D-Xylofuranose, 1,2-O-(1-methylethylidene)-5-O-(triphenylmethyl)- |
| 1,2-O-ISOPROPYLIDENE-5-O-TRIPHENYLMETHYL-ALPHA-D-XYLOFURANOSIDE |
| 1,2-O,O-Dimethyl-myo-inosit |