1,2:3,5-Di-O-isopropylidene-alpha-D-xylofuranose structure
|
Common Name | 1,2:3,5-Di-O-isopropylidene-alpha-D-xylofuranose | ||
|---|---|---|---|---|
| CAS Number | 20881-04-3 | Molecular Weight | 230.258 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 272.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H18O5 | Melting Point | 42-46 °C | |
| MSDS | N/A | Flash Point | 103.7±25.8 °C | |
Use of 1,2:3,5-Di-O-isopropylidene-alpha-D-xylofuranose1,2:3,5-Di-O-isopropylidene-alpha-D-xylofuranose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | (3aR,4aR,8aS,8bR)-2,2,7,7-tetramethyl-4a,5,8a,8b-tetrahydro-3aH-[1,3]dioxolo[3,4]furo[1,3-d][1,3]dioxine |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2:3,5-Di-O-isopropylidene-alpha-D-xylofuranose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 272.2±35.0 °C at 760 mmHg |
| Melting Point | 42-46 °C |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.258 |
| Flash Point | 103.7±25.8 °C |
| Exact Mass | 230.115417 |
| PSA | 46.15000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | NKZDPBSWYPINNF-BZNPZCIMSA-N |
| SMILES | CC1(C)OCC2OC3OC(C)(C)OC3C2O1 |
| Storage condition | 2-8°C |
| Water Solubility | slightly soluble |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| (3aR,3bS,7aR,8aR)-2,2,5,5-Tetramethyltetrahydro-3bH-[1,3]dioxolo[4,5]furo[3,2-d][1,3]dioxine |
| 1,2:3,5-Di-O-isopropylidene-alpha-D-xylofuranose |
| 1,2:3,5-Di-O-isopropylidene-D-xylofuranose |
| D-Xylose diacetonide |
| 1,2:3,5-Di-O-isopropylidene-a-D-xylofuranose |
| 1,2:3,5-Di-O-isopropylidene-α-D-xylofuranose |
| MFCD00063224 |
| 1,2﹕3,5-Di-O-isopropylidene-alpha-D-xylofuranose |