2-methylpropylhydrazine hydrochloride structure
|
Common Name | 2-methylpropylhydrazine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 205985-97-3 | Molecular Weight | 258.06900 | |
| Density | 1.546g/cm3 | Boiling Point | 334ºC at 760 mmHg | |
| Molecular Formula | C9H8BrNO3 | Melting Point | 88-93ºC | |
| MSDS | N/A | Flash Point | 155.8ºC | |
| Name | methyl 3-(5-bromopyridin-3-yl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.546g/cm3 |
|---|---|
| Boiling Point | 334ºC at 760 mmHg |
| Melting Point | 88-93ºC |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.06900 |
| Flash Point | 155.8ºC |
| Exact Mass | 256.96900 |
| PSA | 56.26000 |
| LogP | 1.58990 |
| Vapour Pressure | 0.000132mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | YVDRZMXIMURBFZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1cncc(Br)c1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 5-bromonicotinoylacetate |
| methyl 3-(5-bromo(3-pyridyl))-3-oxopropanoate |
| 3-Pyridinepropanoicacid,5-bromo-b-oxo-,methyl ester |