PHENOL, 4-AMINO-, 1-(4-AMINOBENZOATE) structure
|
Common Name | PHENOL, 4-AMINO-, 1-(4-AMINOBENZOATE) | ||
|---|---|---|---|---|
| CAS Number | 20610-77-9 | Molecular Weight | 228.24700 | |
| Density | 1.286 | Boiling Point | 465.646ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.224ºC | |
| Name | (4-aminophenyl) 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286 |
|---|---|
| Boiling Point | 465.646ºC at 760 mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 254.224ºC |
| Exact Mass | 228.09000 |
| PSA | 78.34000 |
| LogP | 3.23260 |
| InChIKey | LOCTYHIHNCOYJZ-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OC(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2922499990 |
|---|
|
~99%
PHENOL, 4-AMINO... CAS#:20610-77-9 |
| Literature: EP1593713 A1, ; Page/Page column 15 ; |
|
~%
PHENOL, 4-AMINO... CAS#:20610-77-9 |
| Literature: Journal of the Chemical Society, Dalton Transactions, , # 9 p. 1437 - 1445 |
|
~%
PHENOL, 4-AMINO... CAS#:20610-77-9 |
| Literature: Journal of the Chemical Society, Dalton Transactions, , # 9 p. 1437 - 1445 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| p-Aminophenyl-p-aminobenzoat |
| (4-aminophenyl) 4-azanylbenzoate |
| 4,4'-Diamino-phenylbenzoat |
| 4-Aminophenyl 4-aminobenzoate |