4-Nitrobenzoic acid structure
|
Common Name | 4-Nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 62-23-7 | Molecular Weight | 167.119 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 359.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO4 | Melting Point | 237-240 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 166.5±11.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.1±25.0 °C at 760 mmHg |
| Melting Point | 237-240 °C(lit.) |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.119 |
| Flash Point | 166.5±11.6 °C |
| Exact Mass | 167.021851 |
| PSA | 83.12000 |
| LogP | 1.89 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | OTLNPYWUJOZPPA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents, cyanides, strong bases. |
| Water Solubility | <0.1 g/100 mL at 26 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful |
| Risk Phrases | R22 |
| Safety Phrases | S26-S39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | DH5075000 |
| HS Code | 29163900 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
The EpiOcular Eye Irritation Test (EIT) for hazard identification and labelling of eye irritating chemicals: protocol optimisation for solid materials and the results after extended shipment.
Altern. Lab. Anim. 43 , 101-27, (2015) The 7th Amendment to the EU Cosmetics Directive and the EU REACH Regulation have reinforced the need for in vitro ocular test methods. Validated in vitro ocular toxicity tests that can predict the hum... |
|
|
A Comprehensive Metabolomic Investigation in Urine of Mice Exposed to Strontium-90.
Radiat. Res. 183 , 665-74, (2015) Internal emitters such as Strontium-90 ((90)Sr) pose a substantial health risk during and immediately after a nuclear disaster or detonation of an improvised device. The environmental persistency and ... |
|
|
Liver metabolomics reveals increased oxidative stress and fibrogenic potential in gfrp transgenic mice in response to ionizing radiation.
J. Proteome Res. 13(6) , 3065-74, (2014) Although radiation-induced tissue-specific injury is well documented, the underlying molecular changes resulting in organ dysfunction and the consequences thereof on overall metabolism and physiology ... |
| p-Nitrobenzenecarboxylic acid |
| Nitrobenzoic acid |
| p-nitrobenzoic acid |
| 4-Nitrobenzenecarboxylic acid |
| Benzoic acid, 4-nitro- |
| PARA-NITROBENZOIC ACID |
| EINECS 200-526-2 |
| MFCD00007352 |
| Benzoic acid, p-nitro- |
| 4-Nitrobenzoic Acid |