1,3-bis(4-methoxyphenyl)propan-1-one structure
|
Common Name | 1,3-bis(4-methoxyphenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 20615-47-8 | Molecular Weight | 270.32300 | |
| Density | 1.098g/cm3 | Boiling Point | 427.2ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | 1,3-bis(4-methoxyphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 427.2ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 203.9ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.51930 |
| Vapour Pressure | 1.67E-07mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | RBUUTPKKWGVWCJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(=O)c2ccc(OC)cc2)cc1 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-bis-(4-methoxy-phenyl)-propan-1-one |
| 1,3-bis(4-methoxyphenyl)-1-propanone |
| 1,3-di(2,4-dimethoxyphenyl)propan-1-one |
| 1,3-bis-(4-methoxyphenyl)propanone |
| 4'-METHOXY-3-(4-METHOXYPHENYL)PROPIOPHENONE |
| 1,3-di(4-methoxyphenyl)propan-1-one |