1,3-bis(4-chlorophenyl)propan-1-one
1,3-bis(4-chlorophenyl)propan-1-one structure
|
Common Name | 1,3-bis(4-chlorophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 97009-36-4 | Molecular Weight | 279.16100 | |
| Density | 1.257g/cm3 | Boiling Point | 415.3ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-bis(4-chlorophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 415.3ºC at 760 mmHg |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.16100 |
| Flash Point | 175.4ºC |
| Exact Mass | 278.02700 |
| PSA | 17.07000 |
| LogP | 4.80890 |
| Index of Refraction | 1.592 |
| InChIKey | ZDRPIYBPFYVFLT-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914700090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-CHLORO-3-(4-CHLOROPHENYL)PROPIOPHENONE |
| 1-Propanone,1,3-bis(4-chlorophenyl) |
| 1,3-Bis-(4-chlor-phenyl)-propan-1-on |
| 1,3-Bis(4-chlorophenyl)-1-propanone |
| 1,3-bis-(4-chloro-phenyl)-propan-1-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: CAS number of 1,3-bis(4-chlorophenyl)propan-1-one is 97009-36-4. |
| Q: What is the Chinese name of 97009-36-4? |
| A: Chinese name of 97009-36-4 is 97009-36-4. |
| Q: What is the molecular weight of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: Molecular weight of 1,3-bis(4-chlorophenyl)propan-1-one is 279.16100. |
| Q: What is the LogP of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: LogP of 1,3-bis(4-chlorophenyl)propan-1-one is 4.80890. |
| Q: What is the polar surface area (PSA) of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: Polar surface area (PSA) of 1,3-bis(4-chlorophenyl)propan-1-one is 17.07000. |
| Q: What is the molecular formula of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: Molecular formula of 1,3-bis(4-chlorophenyl)propan-1-one is C15H12Cl2O. |
| Q: What English synonyms does 1,3-bis(4-chlorophenyl)propan-1-one have? |
| A: English synonyms of 1,3-bis(4-chlorophenyl)propan-1-one: 4'-CHLORO-3-(4-CHLOROPHENYL)PROPIOPHENONE, 1-Propanone,1,3-bis(4-chlorophenyl), 1,3-Bis-(4-chlor-phenyl)-propan-1-on, 1,3-Bis(4-chlorophenyl)-1-propanone, 1,3-bis-(4-chloro-phenyl)-propan-1-one. |
| Q: What is the boiling point of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: Boiling point of 1,3-bis(4-chlorophenyl)propan-1-one is 415.3ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: SMILES notation of 1,3-bis(4-chlorophenyl)propan-1-one is O=C(CCc1ccc(Cl)cc1)c1ccc(Cl)cc1. |
| Q: What is the InChIKey of 1,3-bis(4-chlorophenyl)propan-1-one? |
| A: InChIKey of 1,3-bis(4-chlorophenyl)propan-1-one is ZDRPIYBPFYVFLT-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |