1,3-bis(4-chlorophenyl)propan-1-one
Modify Date: 2025-08-26 13:01:49
1,3-bis(4-chlorophenyl)propan-1-one structure
|
Common Name | 1,3-bis(4-chlorophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 97009-36-4 | Molecular Weight | 279.16100 | |
| Density | 1.257g/cm3 | Boiling Point | 415.3ºC at 760 mmHg | |
| Molecular Formula | C15H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.4ºC | |
| Name | 1,3-bis(4-chlorophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 415.3ºC at 760 mmHg |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.16100 |
| Flash Point | 175.4ºC |
| Exact Mass | 278.02700 |
| PSA | 17.07000 |
| LogP | 4.80890 |
| Index of Refraction | 1.592 |
| InChIKey | ZDRPIYBPFYVFLT-UHFFFAOYSA-N |
| SMILES | O=C(CCc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-CHLORO-3-(4-CHLOROPHENYL)PROPIOPHENONE |
| 1-Propanone,1,3-bis(4-chlorophenyl) |
| 1,3-Bis-(4-chlor-phenyl)-propan-1-on |
| 1,3-Bis(4-chlorophenyl)-1-propanone |
| 1,3-bis-(4-chloro-phenyl)-propan-1-one |