Tetraphenylphosphonium iodide structure
|
Common Name | Tetraphenylphosphonium iodide | ||
|---|---|---|---|---|
| CAS Number | 2065-67-0 | Molecular Weight | 466.294 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20IP | Melting Point | 343-348 °C(lit.) | |
| MSDS | N/A | Flash Point | 280 °C | |
| Name | tetraphenylphosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 343-348 °C(lit.) |
|---|---|
| Molecular Formula | C24H20IP |
| Molecular Weight | 466.294 |
| Flash Point | 280 °C |
| Exact Mass | 466.034729 |
| PSA | 13.59000 |
| LogP | 1.31000 |
| InChIKey | AEFPPQGZJFTXDR-UHFFFAOYSA-M |
| SMILES | [I-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| Hazard Codes | Xn:Harmful; |
|---|---|
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Phosphonium, tetraphenyl-, iodide (1:1) |
| Tetraphenylphosphoniumiodid |
| phosphonium iodide |
| MFCD00011917 |
| Tetraphenylphosphonium iodide |
| EINECS 218-179-0 |
| tetraphenylphosphanium iodide |