2,6-dibromo-3,3,5,5-tetramethylcyclohexan-1-one structure
|
Common Name | 2,6-dibromo-3,3,5,5-tetramethylcyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2065-76-1 | Molecular Weight | 312.04100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dibromo-3,3,5,5-tetramethylcyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16Br2O |
|---|---|
| Molecular Weight | 312.04100 |
| Exact Mass | 309.95700 |
| PSA | 17.07000 |
| LogP | 3.53860 |
| InChIKey | IZQKDIHFMIWQCL-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)C(Br)C(=O)C1Br |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,6-dibromo-3,3,5,5-tetramethylcyclohexanone |
| EINECS 218-182-7 |
| 2,6-Dibrom-3,3,5,5-tetramethyl-cyclohexanon |