N-(1-Naphthalenyl)-β-oxobenzenepropanamide structure
|
Common Name | N-(1-Naphthalenyl)-β-oxobenzenepropanamide | ||
|---|---|---|---|---|
| CAS Number | 20653-04-7 | Molecular Weight | 289.32800 | |
| Density | 1.244g/cm3 | Boiling Point | 559.3ºC at 760 mmHg | |
| Molecular Formula | C19H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216ºC | |
| Name | N-1-Naphthyl-3-oxo-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 559.3ºC at 760 mmHg |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.32800 |
| Flash Point | 216ºC |
| Exact Mass | 289.11000 |
| PSA | 46.17000 |
| LogP | 4.12430 |
| Vapour Pressure | 1.53E-12mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | VZTJKEXGPHAIKK-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1)Nc1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| benzoylenurea |
| Benzoic acid,ureide |
| Benzoylharnstoff |
| 1-Benzoylurea |
| Benzamide,N-(aminocarbonyl) |
| Urea,benzoyl |
| Ethylbenzoylacetat-2,4-dinitro-phenylhydrazon |
| N-(naphthalen-1-yl)-3-oxo-3-phenylpropanamide |
| N-benzoyl urea |
| Benzoylessigsaeureethylester-2.4-dinitrophenylhydrazon |
| Benzoylurea |
| Benzoylessigsaeure-N-(1-naphthylamid) |