(ACETYLCYCLOPENTADIENYL)CYCLOPENTADIENYLIRON structure
|
Common Name | (ACETYLCYCLOPENTADIENYL)CYCLOPENTADIENYLIRON | ||
|---|---|---|---|---|
| CAS Number | 206557-04-2 | Molecular Weight | 488.29800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22IO2P | Melting Point | 138ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2-oxo-2-prop-2-enoxyethyl)-triphenylphosphanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 138ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C23H22IO2P |
| Molecular Weight | 488.29800 |
| Exact Mass | 488.04000 |
| PSA | 39.89000 |
| LogP | 0.71370 |
| InChIKey | PJGRTFGJXKYEIH-UHFFFAOYSA-M |
| SMILES | C=CCOC(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | UN 2811 6.1/PG 2 |
|
C-glycosidic analogues of lipid A and lipid X: synthesis and biological activities.
J. Med. Chem. 34 , 2759, (1991) The synthesis of a series of novel analogues of lipid A, the lipophilic terminal of lipopolysaccharides (LPS), and lipid X, the reducing monosaccharide unit in lipid A, is reported. In these compounds... |
| MFCD00191712 |
| (Allyloxycarbonylmethyl)triphenylphosphonium iodide |