(+)-3-HYDROXYMORPHINANHYDROBROMIDE structure
|
Common Name | (+)-3-HYDROXYMORPHINANHYDROBROMIDE | ||
|---|---|---|---|---|
| CAS Number | 206761-65-1 | Molecular Weight | 243.18900 | |
| Density | 1.619g/cm3 | Boiling Point | 585.1ºC at 760 mmHg | |
| Molecular Formula | C10H10FNO5 | Melting Point | 192-193ºC (dec.) | |
| MSDS | USA | Flash Point | 307.6ºC | |
| Name | (2R,3R)-4-(4-fluoroanilino)-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.619g/cm3 |
|---|---|
| Boiling Point | 585.1ºC at 760 mmHg |
| Melting Point | 192-193ºC (dec.) |
| Molecular Formula | C10H10FNO5 |
| Molecular Weight | 243.18900 |
| Flash Point | 307.6ºC |
| Exact Mass | 243.05400 |
| PSA | 106.86000 |
| Vapour Pressure | 1.56E-14mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | GEDAGSYSBWTSHH-HTQZYQBOSA-N |
| SMILES | O=C(O)C(O)C(O)C(=O)Nc1ccc(F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (+)-4'-fluorotartanilic acid |
| (+)-4'-fluorotartranilic acid |
| (2R,3R)-4-[(4-fluorophenyl)amino]-2,3-bis(oxidanyl)-4-oxidanylidene-butanoic acid |