3-(4-ACETYL-PIPERAZIN-1-YL)ANILINE structure
|
Common Name | 3-(4-ACETYL-PIPERAZIN-1-YL)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 206879-65-4 | Molecular Weight | 219.28300 | |
| Density | 1.177g/cm3 | Boiling Point | 462.414ºC at 760 mmHg | |
| Molecular Formula | C12H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.46ºC | |
| Name | 1-[4-(3-aminophenyl)piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 462.414ºC at 760 mmHg |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.28300 |
| Flash Point | 233.46ºC |
| Exact Mass | 219.13700 |
| PSA | 49.57000 |
| LogP | 1.52140 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | ZDNZOUXIQFHVEP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(c2cccc(N)c2)CC1 |
| HS Code | 2933599090 |
|---|
|
~99%
3-(4-ACETYL-PIP... CAS#:206879-65-4 |
| Literature: NEUROSEARCH A/S Patent: WO2006/111517 A1, 2006 ; Location in patent: Page/Page column 15 ; |
|
~94%
3-(4-ACETYL-PIP... CAS#:206879-65-4 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2007/18941 A2, 2007 ; Location in patent: Page/Page column 85 ; WO 2007/018941 A2 |
|
~%
3-(4-ACETYL-PIP... CAS#:206879-65-4 |
| Literature: Orus; Martinez; Perez; Oficialdegui; Del Castillo; Mourelle; Lasheras; Del Rio; Monge, Antonio Pharmazie, 2002 , vol. 57, # 8 p. 515 - 518 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-acetyl-4-(3-aminophenyl)piperazine |
| 3-(4-Acetyl-1-piperazinyl)-aniline |
| 1-(4-(3-aminophenyl)piperazin-1-yl)ethanone |
| 3-(1-acetylpiperazin-4-yl)aniline |
| 3-(4-Acetyl-piperazin-1-yl)aniline |