3-(4-Boc-piperazin-1-yl)aniline structure
|
Common Name | 3-(4-Boc-piperazin-1-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 206879-72-3 | Molecular Weight | 277.362 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 442.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H23N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.4±27.3 °C | |
| Name | tert-butyl 4-(3-aminophenyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.4±40.0 °C at 760 mmHg |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.362 |
| Flash Point | 221.4±27.3 °C |
| Exact Mass | 277.179016 |
| PSA | 58.80000 |
| LogP | 0.98 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | GCSOXUVISUKQBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2cccc(N)c2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-tert-butoxycarbonyl-4-(3-aminophenyl)piperazine |
| AB3311 |
| 3-(4-Boc-piperazin-1-yl)aniline |
| 4-(3-AMINO-PHENYL)-PIPERAZINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER |
| 2-Methyl-2-propanyl 4-(3-aminophenyl)-1-piperazinecarboxylate |
| tert-Butyl 4-(3-aminophenyl)piperazine-1-carboxylate |
| 1-Piperazinecarboxylic acid, 4-(3-aminophenyl)-, 1,1-dimethylethyl ester |
| tert-butyl 4-(3-aminophenyl)-1-piperazinecarboxylate |
| (3-amino-phenyl)piperazine-1-carboxylic acid tert-butyl ester |
| 4-(5-aminophenyl)-piperazine-1-carboxylic acid tert-butyl ester |