Z-Trp-NH2 structure
|
Common Name | Z-Trp-NH2 | ||
|---|---|---|---|---|
| CAS Number | 20696-64-4 | Molecular Weight | 337.37200 | |
| Density | 1.305 | Boiling Point | N/A | |
| Molecular Formula | C19H19N3O3 | Melting Point | 188-189ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl N-[(2S)-1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305 |
|---|---|
| Melting Point | 188-189ºC |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.37200 |
| Exact Mass | 337.14300 |
| PSA | 97.21000 |
| LogP | 3.58190 |
| InChIKey | GGRKLCWXRBTPLH-KRWDZBQOSA-N |
| SMILES | NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~90%
Z-Trp-NH2 CAS#:20696-64-4 |
| Literature: US2011/172442 A1, ; Page/Page column 16 ; |
|
~%
Z-Trp-NH2 CAS#:20696-64-4 |
| Literature: US2007/111930 A1, ; Page/Page column 22 ; |
|
~98%
Z-Trp-NH2 CAS#:20696-64-4 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 61, # 7 p. 2647 - 2648 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Z-(L)-Trp-NH2 |
| N-Carbobenzoxy-L-tryptophanamide |
| Nalpha-Z-L-tryptophan amide |