1-Nitro-3-oxiranylbenzene structure
|
Common Name | 1-Nitro-3-oxiranylbenzene | ||
|---|---|---|---|---|
| CAS Number | 20697-05-6 | Molecular Weight | 165.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (+/-)-1-(3-nitrophenyl)oxirane |
|---|
| Molecular Formula | C8H7NO3 |
|---|---|
| Molecular Weight | 165.14600 |
| Exact Mass | 165.04300 |
| PSA | 58.35000 |
| LogP | 2.18930 |
| InChIKey | VVZFDVJTIOLMKC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C2CO2)c1 |
| HS Code | 2910900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |