tert-butyl 4-(2-oxopropyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(2-oxopropyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 206989-54-0 | Molecular Weight | 241.32700 | |
| Density | 1.023g/cm3 | Boiling Point | 328.35ºC at 760 mmHg | |
| Molecular Formula | C13H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.381ºC | |
| Name | tert-butyl 4-(2-oxopropyl)piperidine-1-carboxylate |
|---|
| Density | 1.023g/cm3 |
|---|---|
| Boiling Point | 328.35ºC at 760 mmHg |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.32700 |
| Flash Point | 152.381ºC |
| Exact Mass | 241.16800 |
| PSA | 46.61000 |
| LogP | 2.55050 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | UNUNCPXYUNVRRF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |