nonafluoro-4-trifluoromethyl-2-pentene structure
|
Common Name | nonafluoro-4-trifluoromethyl-2-pentene | ||
|---|---|---|---|---|
| CAS Number | 2070-70-4 | Molecular Weight | 300.04500 | |
| Density | 1.5873 | Boiling Point | 49 °C | |
| Molecular Formula | C6F12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 0.1ºC | |
| Name | Perfluoro(4-methylpent-2-ene) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5873 |
|---|---|
| Boiling Point | 49 °C |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04500 |
| Flash Point | 0.1ºC |
| Exact Mass | 299.98100 |
| LogP | 4.53220 |
| Vapour Pressure | 215mmHg at 25°C |
| Index of Refraction | 1.268 |
| InChIKey | SAPOZTRFWJZUFT-UHFFFAOYSA-N |
| SMILES | FC(=C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S23-S24/25 |
| HS Code | 2903399090 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| hexafluoropropene dimer |
| perfluoro-4-methylpent-2-ene |
| MFCD00153253 |
| perfluoro-2-methyl-3-pentene |
| 1,1,1,2,3,4,5,5,5-nonafluoro-4-trifluoromethyl-pent-2-ene |
| nonafluoro-4-trifluoromethyl-2-pentene |
| perfluoro-4-methyl-2-pentene |