Mebeverine alcohol D5 structure
|
Common Name | Mebeverine alcohol D5 | ||
|---|---|---|---|---|
| CAS Number | 2070015-15-3 | Molecular Weight | 270.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22D5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mebeverine alcohol D5Mebeverine alcohol D5 is the deuterium labeled Mebeverine alcohol, which is a metabolite of Mebeverine. |
| Name | Mebeverine alcohol D5 |
|---|
| Description | Mebeverine alcohol D5 is the deuterium labeled Mebeverine alcohol, which is a metabolite of Mebeverine. |
|---|---|
| Related Catalog |
| Molecular Formula | C16H22D5NO2 |
|---|---|
| Molecular Weight | 270.42 |
| InChIKey | ZGZAPRVKIAFOPL-SGEUAGPISA-N |
| SMILES | CCN(CCCCO)C(C)Cc1ccc(OC)cc1 |