Mebeverine metabolite O-desmethyl Mebeverine alcohol structure
|
Common Name | Mebeverine metabolite O-desmethyl Mebeverine alcohol | ||
|---|---|---|---|---|
| CAS Number | 155172-67-1 | Molecular Weight | 251.36400 | |
| Density | 1.041g/cm3 | Boiling Point | 400.1ºC at 760mmHg | |
| Molecular Formula | C15H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
Use of Mebeverine metabolite O-desmethyl Mebeverine alcoholMebeverine metabolite O-desmethyl Mebeverine alcohol is a metabolite of Mebeverine, which is a potent α1 repector inhibitor, causing relaxation of the gastrointestinal tract. |
| Name | 4-[2-[ethyl(4-hydroxybutyl)amino]propyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Description | Mebeverine metabolite O-desmethyl Mebeverine alcohol is a metabolite of Mebeverine, which is a potent α1 repector inhibitor, causing relaxation of the gastrointestinal tract. |
|---|---|
| Related Catalog | |
| Target |
α1 repector |
| Density | 1.041g/cm3 |
|---|---|
| Boiling Point | 400.1ºC at 760mmHg |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.36400 |
| Flash Point | 191.7ºC |
| Exact Mass | 251.18900 |
| PSA | 43.70000 |
| LogP | 2.41760 |
| Vapour Pressure | 4.04E-07mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | RNGYIAYXMHMWTO-UHFFFAOYSA-N |
| SMILES | CCN(CCCCO)C(C)Cc1ccc(O)cc1 |
| 4-(2-(Ethyl(4-hydroxybutyl)amino)propyl)phenol |
| Phenol,4-(2-(ethyl(4-hydroxybutyl)amino)propyl) |
| Desmethylmebeverine alcohol |
| 4-[2-(Ethyl-(4-Hydroxybutyl)Amino)Propyl]Phenol |
| Mebeverine metabolite O-desmethyl Mebeverine alcohol |