Ethyl 4-chloro-6-nitroquinoline-3-carboxylate structure
|
Common Name | Ethyl 4-chloro-6-nitroquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 207231-24-1 | Molecular Weight | 289.63800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-chloro-6,7,8-trifluoroquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7ClF3NO2 |
|---|---|
| Molecular Weight | 289.63800 |
| Exact Mass | 289.01200 |
| PSA | 39.19000 |
| LogP | 3.48220 |
| InChIKey | WCFMOGCTVPWEFW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(F)c(F)c(F)cc2c1Cl |
| HS Code | 2933499090 |
|---|
|
~79%
Ethyl 4-chloro-... CAS#:207231-24-1 |
| Literature: Hao, Qun; Pan, Jing; Li, Yongjia; Cai, Zhengyan; Zhou, Weicheng Organic Process Research and Development, 2013 , vol. 17, # 6 p. 921 - 926 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 6,7,8-trifluoro-4-chloro-quinoline-3-carboxylate |
| ethyl 4-chloro-6,7,8-trifluoroquinoline 3-carboxylate |