Ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate structure
|
Common Name | Ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 31602-09-2 | Molecular Weight | 263.71900 | |
| Density | 1.222g/cm3 | Boiling Point | 363.3ºC at 760mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.5ºC | |
| Name | Ethyl 4-chloro-6,8-dimethylquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 363.3ºC at 760mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 173.5ºC |
| Exact Mass | 263.07100 |
| PSA | 39.19000 |
| LogP | 3.68170 |
| Index of Refraction | 1.593 |
| InChIKey | QOCJKSWVYYUBSD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(C)cc(C)cc2c1Cl |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 4-Chloro-6,8-Dimethyl-3-Quinolinecarboxylate |
| 4-chloro-6,8-dimethyl-quinoline-3-carboxylic acid ethyl ester |
| 4-Chlor-6,8-dimethyl-chinolin-3-carbonsaeure-ethylester |