2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde structure
|
Common Name | 2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 207233-99-6 | Molecular Weight | 267.24600 | |
| Density | 1.2g/cm3 | Boiling Point | 350ºC at 760 mmHg | |
| Molecular Formula | C14H12F3NO | Melting Point | 103-105ºC(lit.) | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | 2,5-dimethyl-1-[3-(trifluoromethyl)phenyl]pyrrole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 350ºC at 760 mmHg |
| Melting Point | 103-105ºC(lit.) |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.24600 |
| Flash Point | 165.5ºC |
| Exact Mass | 267.08700 |
| PSA | 22.00000 |
| LogP | 3.92540 |
| Vapour Pressure | 4.53E-05mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | JHWUPSAKKXZTKT-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=O)c(C)n1-c1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Dimethyl-1-[3-(trifluoromethyl)phenyl]-1H-pyrrole-3-carbaldehyde |
| 2,4-DIMETHYL-3-HEPTANOL,THREO + ERYTHRO |