H-Ala-Asp-OH structure
|
Common Name | H-Ala-Asp-OH | ||
|---|---|---|---|---|
| CAS Number | 20727-65-5 | Molecular Weight | 204.18100 | |
| Density | 1.42 g/cm3 | Boiling Point | 455.9ºC at 760 mmHg | |
| Molecular Formula | C7H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | h-ala-asp-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42 g/cm3 |
|---|---|
| Boiling Point | 455.9ºC at 760 mmHg |
| Molecular Formula | C7H12N2O5 |
| Molecular Weight | 204.18100 |
| Flash Point | 229.5ºC |
| Exact Mass | 204.07500 |
| PSA | 129.72000 |
| Vapour Pressure | 1.4E-09mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | XAEWTDMGFGHWFK-IMJSIDKUSA-M |
| SMILES | CC([NH3+])C(=O)NC(CC(=O)[O-])C(=O)[O-] |
| HS Code | 2924199090 |
|---|
|
~%
H-Ala-Asp-OH CAS#:20727-65-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 61, # 12 p. 4447 - 4448 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-L-alanyl-L-Aspartic acid |
| Alanylaspartate |
| L-ALANYL-L-ASPARTIC ACID |
| L-alanyl-aspartic acid |
| L-Aspartic acid,N-L-alanyl |
| alanylaspartic acid |
| L-ALa-L-Asp |