Methyl sinapate structure
|
Common Name | Methyl sinapate | ||
|---|---|---|---|---|
| CAS Number | 20733-94-2 | Molecular Weight | 238.24 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 372.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.6±20.0 °C | |
Use of Methyl sinapateMethyl sinapate (MSA), a hydroxycinnamic acid, is a natural UV screening agent[1][2]. |
| Name | methyl (E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyl sinapate (MSA), a hydroxycinnamic acid, is a natural UV screening agent[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.3±37.0 °C at 760 mmHg |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 |
| Flash Point | 140.6±20.0 °C |
| Exact Mass | 238.084122 |
| PSA | 64.99000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | JHLPYWLKSLVYOI-SNAWJCMRSA-N |
| SMILES | COC(=O)C=Cc1cc(OC)c(O)c(OC)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)acrylate |
| methyl sinapate |
| methyl sinapinate |
| Antithiamine factor |
| 4-hydroxy-3,5-dimethoxycinnamic acid methyl ester |
| Methylsinapat |
| Sinapinsaeuremethylester |
| 3,5-Dimethoxy-4-hydroxy cinnamic acid methyl ester |
| 2-Propenoic acid, 3-(4-hydroxy-3,5-dimethoxyphenyl)-, methyl ester, (2E)- |
| methyl (2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoate |
| sinapic acid methyl ester |