Arteannuin N structure
|
Common Name | Arteannuin N | ||
|---|---|---|---|---|
| CAS Number | 207446-92-2 | Molecular Weight | 250.333 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 412.2±14.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3±16.6 °C | |
Use of Arteannuin NArteannuin N can be isolated from Artemisia annua, and can be used for anti-malarial research[1]. |
| Name | (2R)-2-[(1R,4R,4aS,8aS)-4,7-Dimethyl-8-oxo-1,2,3,4,4a,5,8,8a-octa hydro-1-naphthalenyl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Arteannuin N can be isolated from Artemisia annua, and can be used for anti-malarial research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.2±14.0 °C at 760 mmHg |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.333 |
| Flash Point | 217.3±16.6 °C |
| Exact Mass | 250.156891 |
| PSA | 54.37000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.502 |
| InChIKey | IYDIAJDXEYNLGO-WSLQDRLSSA-N |
| SMILES | CC1=CCC2C(C)CCC(C(C)C(=O)O)C2C1=O |
| Hazard Codes | Xi |
|---|
| (2R)-2-[(1R,4R,4aS,8aS)-4,7-Dimethyl-8-oxo-1,2,3,4,4a,5,8,8a-octahydro-1-naphthalenyl]propanoic acid |
| Arteannuin N |