Solvent Red 135 structure
|
Common Name | Solvent Red 135 | ||
|---|---|---|---|---|
| CAS Number | 20749-68-2 | Molecular Weight | 408.065 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 646.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C18H6Cl4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 344.6±34.3 °C | |
| Name | 8,9,10,11-Tetrachloro-12H-isoindolo-[2,1-a]perimidin-12-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 646.3±65.0 °C at 760 mmHg |
| Molecular Formula | C18H6Cl4N2O |
| Molecular Weight | 408.065 |
| Flash Point | 344.6±34.3 °C |
| Exact Mass | 405.923431 |
| PSA | 34.89000 |
| LogP | 5.05 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.809 |
| InChIKey | UBZVRROHBDDCQY-UHFFFAOYSA-N |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C2=Nc3cccc4cccc(c34)N12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 3204120000 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Filester Red GA |
| 8,9,10,11-tetrachloro-12H-phthaloperin-12-one |
| Solvent Red 162 |
| Oplas Red 339 |
| Elbaplast Red G |
| Kayaset Red A-G |
| SOLVENT RED 135 |
| 8,9,10,11-tetrachloro-12-phthaloperinone |
| Sumiplast Red H2G |
| 12H-Phthaloperin-12-one, 8,9,10,11-tetrachloro- |
| 8,9,10,11-Tetrachloro-12H-isoindolo[2,1-a]perimidin-12-one |
| Waxoline Red YP-FW. |