Methyl (2E)-3-[4-(trifluoromethyl)phenyl]acrylate structure
|
Common Name | Methyl (2E)-3-[4-(trifluoromethyl)phenyl]acrylate | ||
|---|---|---|---|---|
| CAS Number | 20754-22-7 | Molecular Weight | 230.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 256.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.4±18.2 °C | |
| Name | methyl 4-trifluoromethylcinnamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 256.8±35.0 °C at 760 mmHg |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.183 |
| Flash Point | 91.4±18.2 °C |
| Exact Mass | 230.055466 |
| PSA | 26.30000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | YUEFITCWDISQAO-QPJJXVBHSA-N |
| SMILES | COC(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid, 3-[4-(trifluoromethyl)phenyl]-, methyl ester, (2E)- |
| Methyl (2E)-3-[4-(trifluoromethyl)phenyl]acrylate |