3-(4-hydroxyphenyl)-2-[[3-(1H-indol-3-yl)-2-phenylmethoxycarbonylamino-propanoyl]amino]propanoic acid structure
|
Common Name | 3-(4-hydroxyphenyl)-2-[[3-(1H-indol-3-yl)-2-phenylmethoxycarbonylamino-propanoyl]amino]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 20762-34-9 | Molecular Weight | 501.53000 | |
| Density | 1.365g/cm3 | Boiling Point | 869.1ºC at 760 mmHg | |
| Molecular Formula | C28H27N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 479.4ºC | |
| Name | 3-(4-hydroxyphenyl)-2-[[3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 869.1ºC at 760 mmHg |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.53000 |
| Flash Point | 479.4ºC |
| Exact Mass | 501.19000 |
| PSA | 140.75000 |
| LogP | 4.30490 |
| Vapour Pressure | 2.93E-32mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | SMLAYVNSQQMPHO-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(=O)O)OCc1ccccc1 |
|
~%
3-(4-hydroxyphe... CAS#:20762-34-9 |
| Literature: Smith Journal of Biological Chemistry, 1948 , vol. 175, p. 39,46 |
|
~%
3-(4-hydroxyphe... CAS#:20762-34-9 |
| Literature: Smith Journal of Biological Chemistry, 1948 , vol. 175, p. 39,46 |
|
~%
3-(4-hydroxyphe... CAS#:20762-34-9 |
| Literature: Smith Journal of Biological Chemistry, 1948 , vol. 175, p. 39,46 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(4-hydroxyphenyl)-2-[[3-(1H-indol-3-yl)-2-phenylmethoxycarbonylamino-propanoyl]amino]propanoic acid |