N-Acetyl-3,5-dinitrotyrosine structure
|
Common Name | N-Acetyl-3,5-dinitrotyrosine | ||
|---|---|---|---|---|
| CAS Number | 20767-00-4 | Molecular Weight | 313.220 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 583.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C11H11N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.5±30.1 °C | |
| Name | N-Acetyl-3,5-dinitro-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 583.2±50.0 °C at 760 mmHg |
| Molecular Formula | C11H11N3O8 |
| Molecular Weight | 313.220 |
| Flash Point | 306.5±30.1 °C |
| Exact Mass | 313.054626 |
| PSA | 178.27000 |
| LogP | 0.43 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | CFKZKLOBRPCKTF-ZETCQYMHSA-N |
| SMILES | CC(=O)NC(Cc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1)C(=O)O |
| Storage condition | 2-8°C |
| WGK Germany | 3 |
|---|---|
| HS Code | 2924299090 |
|
~%
N-Acetyl-3,5-di... CAS#:20767-00-4 |
| Literature: Journal of Organic Chemistry, , vol. 18, p. 83,87 |
|
~%
N-Acetyl-3,5-di... CAS#:20767-00-4 |
| Literature: Journal of the Chemical Society, , p. 3424,3432 |
|
~%
N-Acetyl-3,5-di... CAS#:20767-00-4 |
| Literature: Journal of the Chemical Society, , p. 3424,3432 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(acetylamino)-3-(4-hydroxy-3,5-dinitrophenyl)propanoic acid |
| Tyrosine, N-acetyl-3,5-dinitro- |
| MFCD00024239 |
| ACETYL-3,5-DINITRO-4-HYDROXY-L-PHENYLALANINE |
| N-Acetyl-3,5-dinitrotyrosine |
| AC-3,5-DINITRO-TYR-OH |
| 3,5-Dinitro-N-acetyl-L-tyrosin |
| 3,5-DINITROACETYL-L-TYROSINE |
| N-acetyl-3-5-dinitro-L-tyrosine*crystalline |
| ACETYL-3,5-DINITRO-L-TYROSINE |