Sodium |p|-toluenesulfinate structure
|
Common Name | Sodium |p|-toluenesulfinate | ||
|---|---|---|---|---|
| CAS Number | 207801-20-5 | Molecular Weight | 196.19900 | |
| Density | N/A | Boiling Point | 340ºC at 760 mmHg | |
| Molecular Formula | C7H9NaO3S | Melting Point | >300ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 159.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | p-toluenesulfinic acid sodium salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 340ºC at 760 mmHg |
|---|---|
| Melting Point | >300ºC(lit.) |
| Molecular Formula | C7H9NaO3S |
| Molecular Weight | 196.19900 |
| Flash Point | 159.4ºC |
| Exact Mass | 196.01700 |
| PSA | 68.57000 |
| LogP | 2.03440 |
| Appearance of Characters | Crystalline Powder or Flakes | White to off-white |
| Vapour Pressure | 3.42E-05mmHg at 25°C |
| InChIKey | WUHWAOGAJFMIFU-UHFFFAOYSA-M |
| SMILES | Cc1ccc(S(=O)[O-])cc1.O.[Na+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | XT4725000 |
| MFCD00149640 |
| p-Toluenesulfinic acid sodium salt |
| p-Toluenesulfinic acid hydrate sodium salt |
| Sodium p-toluenesulfinate hydrate |
| EINECS 212-538-5 |
| Sodium p-toluenesulfinate |