2-fluoro-3-(trifluoromethyl)benzophenone structure
|
Common Name | 2-fluoro-3-(trifluoromethyl)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 207853-70-1 | Molecular Weight | 268.20600 | |
| Density | 1.32 g/mL at 25 °C(lit.) | Boiling Point | 290 °C(lit.) | |
| Molecular Formula | C14H8F4O | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [2-fluoro-3-(trifluoromethyl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 290 °C(lit.) |
| Molecular Formula | C14H8F4O |
| Molecular Weight | 268.20600 |
| Flash Point | >230 °F |
| Exact Mass | 268.05100 |
| PSA | 17.07000 |
| LogP | 4.07550 |
| Vapour Pressure | 7.18E-05mmHg at 25°C |
| Index of Refraction | n20/D 1.526(lit.) |
| InChIKey | QNEOCRQLKSEYEM-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cccc(C(F)(F)F)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00061151 |
| 2-Fluoro-3-(trifluoromethyl)benzophenone |
| (2-fluoro-3-(trifluoromethyl)phenyl)(phenyl)methanone |