2,3,4-TRIFLUOROCINNAMICACID structure
|
Common Name | 2,3,4-TRIFLUOROCINNAMICACID | ||
|---|---|---|---|---|
| CAS Number | 207915-99-9 | Molecular Weight | 280.57900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H12ClF6N2P | Melting Point | 99-104ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [chloro(dimethylamino)methylidene]-dimethylazanium,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 99-104ºC |
|---|---|
| Molecular Formula | C5H12ClF6N2P |
| Molecular Weight | 280.57900 |
| Exact Mass | 280.03300 |
| PSA | 19.84000 |
| LogP | 3.79730 |
| InChIKey | CUKNPSDEURGZCO-UHFFFAOYSA-N |
| SMILES | CN(C)C(Cl)=[N+](C)C.F[P-](F)(F)(F)(F)F |
| Storage condition | 2~8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3.0 |
|
COMU: a safer and more effective replacement for benzotriazole-based uronium coupling reagents.
Chemistry 15 , 9404-9416, (2009) We describe a new family of uronium-type coupling reagents that differ in their iminium moieties and leaving groups. The presence of the morpholino group in conjunction with an oxime derivative--espec... |
|
|
N,N,N',N'-tetramethylchloroformamidinium hexafluorophosphate (TCFH), a powerful coupling reagent for bioconjugation.
Bioconjug. Chem. 19 , 1968-1971, (2008) Prodrugs are increasingly used as delivery vehicles for pharmaceutical agents that present solubility and/or pharmacokinetic/metabolic issues. In the course of the development of prodrugs for the anti... |
|
|
L.A. Carpino, A. El-Faham
J. Am. Chem. Soc. 117 , 5401, (1995)
|
| MFCD01862891 |
| Chloro(dimethylamino)-N,N-dimethylmethaniminium hexafluorophosphate |
| Chloro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate |
| TCFH |
| N-[Chloro(dimethylamino)methylene]-N-methylmethanaminium hexafluorophosphate |
| Chloro-N,N,N’,N’-tetramethylformamidinium hexafluorophosphate |
| N,N,N′,N′-Tetramethylchloroformamidinium-hexafluorophosphate |
| N,N,N‘,N‘-Tetramethylchloroformamidinium-hexafluorophosphate |
| CHLORO-N,N,N',N'-TETRAMETHYLFORMAMIDINIUMHEXAFLUOROPHOSPHATE |
| TCFH,Chloro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate |
| N,N,N',N'-Tetramethylchloroformamidinium-hexafluorophosphate |