[3-(3-fluorophenyl)cyclohexen-1-yl]oxy-trimethylsilane structure
|
Common Name | [3-(3-fluorophenyl)cyclohexen-1-yl]oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 207917-03-1 | Molecular Weight | 264.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21FOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-(3-fluorophenyl)cyclohexen-1-yl]oxy-trimethylsilane |
|---|
| Molecular Formula | C15H21FOSi |
|---|---|
| Molecular Weight | 264.41100 |
| Exact Mass | 264.13500 |
| PSA | 9.23000 |
| LogP | 4.82860 |
| InChIKey | MZUGGWVVCJGSEL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC1=CC(c2cccc(F)c2)CCC1 |
|
~%
[3-(3-fluorophe... CAS#:207917-03-1 |
| Literature: Belli Paolobelli, Anna; Ruzziconi, Renzo; Lupattelli, Paolo; Scafato, Patrizia; Spezzacatena, Caterina Journal of Organic Chemistry, 1999 , vol. 64, # 9 p. 3364 - 3368 |
|
~%
[3-(3-fluorophe... CAS#:207917-03-1 |
| Literature: Gourves; Ruzziconi; Vilarroig Journal of Organic Chemistry, 2001 , vol. 66, # 2 p. 617 - 619 |