3-Fluorophenylmagnesium bromide solution structure
|
Common Name | 3-Fluorophenylmagnesium bromide solution | ||
|---|---|---|---|---|
| CAS Number | 17318-03-5 | Molecular Weight | 199.30300 | |
| Density | 1.024 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C6H4BrFMg | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | <1 °F | |
| Symbol |
GHS02, GHS05, GHS07, GHS08 |
Signal Word | Danger | |
| Name | 3-fluorophenylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.024 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C6H4BrFMg |
| Molecular Weight | 199.30300 |
| Flash Point | <1 °F |
| Exact Mass | 197.93300 |
| LogP | 2.47150 |
| InChIKey | DTKMKZYEOXZPQZ-UHFFFAOYSA-M |
| SMILES | Fc1c[c-]ccc1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | It reacts violently with water. |
| Symbol |
GHS02, GHS05, GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H314-H335-H351 |
| Supplemental HS | May form explosive peroxides., Reacts violently with water. |
| Precautionary Statements | P210-P260-P280-P305 + P351 + P338-P370 + P378-P403 + P235 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US) |
| Hazard Codes | F: Flammable;C: Corrosive; |
| Risk Phrases | R11 |
| Safety Phrases | 16-26-33-36/37/39-45-7/8-43 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
3-Fluorophenylm... CAS#:17318-03-5 |
| Literature: Tetrahedron Letters, , vol. 40, # 42 p. 7449 - 7453 |
| Precursor 1 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00672007 |
| magnesium,fluorobenzene,bromide |
| 3-Fluorophenylmagnesium bromide |