1-(4'-chlorobenzenesulfonyl)-3,3-dimethylbutane-2-one structure
|
Common Name | 1-(4'-chlorobenzenesulfonyl)-3,3-dimethylbutane-2-one | ||
|---|---|---|---|---|
| CAS Number | 207974-06-9 | Molecular Weight | 274.76400 | |
| Density | 1.232g/cm3 | Boiling Point | 412.1ºC at 760mmHg | |
| Molecular Formula | C12H15ClO3S | Melting Point | 95-97°C | |
| MSDS | N/A | Flash Point | 203ºC | |
| Name | 1-(4-chlorophenyl)sulfonyl-3,3-dimethylbutan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 412.1ºC at 760mmHg |
| Melting Point | 95-97°C |
| Molecular Formula | C12H15ClO3S |
| Molecular Weight | 274.76400 |
| Flash Point | 203ºC |
| Exact Mass | 274.04300 |
| PSA | 59.59000 |
| LogP | 3.80970 |
| Vapour Pressure | 5.32E-07mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | XTIUXIMZIKBBSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S22-S24/25 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| hms1667m06 |
| MFCD00082685 |