2-fluoro-4-(trifluoromethyl)benzophenone structure
|
Common Name | 2-fluoro-4-(trifluoromethyl)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 207974-08-1 | Molecular Weight | 268.20600 | |
| Density | 1.306g/cm3 | Boiling Point | 328.7ºC at 760mmHg | |
| Molecular Formula | C14H8F4O | Melting Point | 38-40°C | |
| MSDS | N/A | Flash Point | 126ºC | |
| Name | [2-fluoro-4-(trifluoromethyl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 328.7ºC at 760mmHg |
| Melting Point | 38-40°C |
| Molecular Formula | C14H8F4O |
| Molecular Weight | 268.20600 |
| Flash Point | 126ºC |
| Exact Mass | 268.05100 |
| PSA | 17.07000 |
| LogP | 4.07550 |
| Vapour Pressure | 0.000186mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | VXVJVWCUWZLUIJ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(C(F)(F)F)cc1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-Fluoro-4-(trifluoromethyl)benzophenone |
| MFCD00061253 |
| fxffr cf dvr |