1-[2-Fluoro-5-(triFluoromethyl)Phenyl]Propan-1-One structure
|
Common Name | 1-[2-Fluoro-5-(triFluoromethyl)Phenyl]Propan-1-One | ||
|---|---|---|---|---|
| CAS Number | 207974-18-3 | Molecular Weight | 220.16400 | |
| Density | 1.256±0.06 g/cm3(Predicted) | Boiling Point | 198.3±35.0 °C(Predicted) | |
| Molecular Formula | C10H8F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2'-fluoro-5'-(trifluoromethyl)propiophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 198.3±35.0 °C(Predicted) |
| Molecular Formula | C10H8F4O |
| Molecular Weight | 220.16400 |
| Exact Mass | 220.05100 |
| PSA | 17.07000 |
| LogP | 3.43720 |
| Index of Refraction | 1.449 |
| InChIKey | SCKAMDGXXQFMFY-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(C(F)(F)F)ccc1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| MFCD00061260 |
| 2'-fluoro-4'-methylacetophenone |