3-fluoro-5-(trifluoromethyl)benzamide structure
|
Common Name | 3-fluoro-5-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 207986-20-7 | Molecular Weight | 207.12500 | |
| Density | 1.42g/cm3 | Boiling Point | 197.8ºC at 760mmHg | |
| Molecular Formula | C8H5F4NO | Melting Point | 115-117°C | |
| MSDS | N/A | Flash Point | 73.4ºC | |
| Name | 3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 197.8ºC at 760mmHg |
| Melting Point | 115-117°C |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.12500 |
| Flash Point | 73.4ºC |
| Exact Mass | 207.03100 |
| PSA | 43.09000 |
| LogP | 2.64370 |
| Vapour Pressure | 0.372mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | BBUBHNZCRQRAQG-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-fluoro-3-(trifluoromethyl)benzamide |
| MFCD00061149 |