Di-p-tolylacetic acid structure
|
Common Name | Di-p-tolylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 20809-78-3 | Molecular Weight | 240.29700 | |
| Density | 1.126g/cm3 | Boiling Point | 332.1ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8ºC | |
| Name | 2,2-bis(4-methylphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 332.1ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 168.8ºC |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 3.51990 |
| Vapour Pressure | 5.96E-05mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | DRVBWVSGMCHHOU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C(=O)O)c2ccc(C)cc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| Acetic acid,di-p-tolyl |
| ACETIC ACID,BIS(p-TOLYL) |
| Di-p-tolyl-essigsaeure |
| Bis(p-tolyl)-acetic acid |
| di(4-methylphenyl)-acetic acid |
| Di-p-tolylacetic acid |
| 2,2-Bis(p-tolyl) acetic acid |