4,4'-dimethylbenzil structure
|
Common Name | 4,4'-dimethylbenzil | ||
|---|---|---|---|---|
| CAS Number | 3457-48-5 | Molecular Weight | 238.28100 | |
| Density | 1.119 g/cm3 | Boiling Point | 211 °C (7 mmHg) | |
| Molecular Formula | C16H14O2 | Melting Point | 102-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.6ºC | |
| Name | 1,2-bis(4-methylphenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119 g/cm3 |
|---|---|
| Boiling Point | 211 °C (7 mmHg) |
| Melting Point | 102-104 °C(lit.) |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28100 |
| Flash Point | 168.6ºC |
| Exact Mass | 238.09900 |
| PSA | 34.14000 |
| LogP | 3.36900 |
| Index of Refraction | 1.58 |
| InChIKey | BCWCEHMHCDCJAD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(=O)c2ccc(C)cc2)cc1 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Excited carbonyl formation in the combination and disproportionation of free radicals.
J. Biolumin. Chemilumin. 7(1) , 27-35, (1992) The pyrolyisis of di-tert-butyl peroxyoxalate in the presence of para-substituted benzaldehydes produces almost quantitatively the corresponding p,p'-disubstituted benzils. The formation of these prod... |
| p-Tolil |
| 1,2-bis(p-methylphenyl)ethanedione |
| EINECS 222-388-2 |
| 1,2-di(4-methylphenyl)-1,2-ethanedione |
| Di-p-tolylethanedione |
| 4,4'-Dimethylbenzil |
| 1,2-Di-p-tolylethane-1,2-dione |
| Ethandione,bis(p-tolyl) |
| 1,2-bis(4-methoxyphenyl)-ethane-1,2-dione |
| 4,4'-dimethylbibenzoyl |
| MFCD00008554 |