tert-Butyl 4-(2-chloroethyl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(2-chloroethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 208167-83-3 | Molecular Weight | 248.750 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 318.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H21ClN2O2 | Melting Point | 67-69ºC | |
| MSDS | N/A | Flash Point | 146.4±26.5 °C | |
| Name | tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.4±37.0 °C at 760 mmHg |
| Melting Point | 67-69ºC |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.750 |
| Flash Point | 146.4±26.5 °C |
| Exact Mass | 248.129150 |
| PSA | 32.78000 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | MYOWELLYEZMECA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCl)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~51%
tert-Butyl 4-(2... CAS#:208167-83-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH; BOEHRINGER INGELHEIM PHARMA GMBH and CO. KG Patent: WO2006/107923 A1, 2006 ; Location in patent: Page/Page column 65-66 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperazinecarboxylic acid, 4-(2-chloroethyl)-, 1,1-dimethylethyl ester |
| 1-tert-butoxycarbonyl-4-(2-chloroethyl)piperazine |
| tert-butyl 4-(2-chloroethyl)piperazine-1-carboxylate |
| 1-Boc-4-(2-chloroethyl)piperazine |
| 4-(2-chloroethyl)piperazine-1-carboxylic acid tert-butyl ester |
| 2-Methyl-2-propanyl 4-(2-chloroethyl)-1-piperazinecarboxylate |
| CA-0897 |
| 4-(2-Chloro-ethyl)-piperazine-1-carboxylic acid tert-butyl ester |