2-fluoro-6-(trifluoromethyl)benzophenone structure
|
Common Name | 2-fluoro-6-(trifluoromethyl)benzophenone | ||
|---|---|---|---|---|
| CAS Number | 208173-18-6 | Molecular Weight | 268.206 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H8F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.0±22.1 °C | |
| Name | [2-fluoro-6-(trifluoromethyl)phenyl]-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.2±42.0 °C at 760 mmHg |
| Molecular Formula | C14H8F4O |
| Molecular Weight | 268.206 |
| Flash Point | 136.0±22.1 °C |
| Exact Mass | 268.051117 |
| PSA | 17.07000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | GZERPYCCZRGZNF-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1c(F)cccc1C(F)(F)F |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Methanone, [2-fluoro-6-(trifluoromethyl)phenyl]phenyl- |
| 2-fluoro-6-(trifluoromethyl)benzophenone |
| [2-Fluoro-6-(trifluoromethyl)phenyl](phenyl)methanone |