2-Fluoro-3-(trifluoromethyl)benzoyl chloride structure
|
Common Name | 2-Fluoro-3-(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 208173-19-7 | Molecular Weight | 226.555 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 202.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H3ClF4O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 76.4±27.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-fluoro-3-(trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 202.8±40.0 °C at 760 mmHg |
| Molecular Formula | C8H3ClF4O |
| Molecular Weight | 226.555 |
| Flash Point | 76.4±27.3 °C |
| Exact Mass | 225.980850 |
| PSA | 17.07000 |
| LogP | 2.92 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | RIKGRFSGIOOYEK-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cccc(C(F)(F)F)c1F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S23-S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2916399090 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and structural characterization of new phosphinooxazoline complexes of iron. Sedinkin SL, et al.
J. Organomet. Chem. 693(18) , 3081-91, (2008)
|
| Benzoyl chloride, 2-fluoro-3-(trifluoromethyl)- |
| GVR BF CXFFF |
| 2-Fluoro-3-(trifluoromethyl)benzoyl chloride |
| MFCD00061154 |
| α,α,α,2-Tetrafluoro-m-toluoyl chloride |