3-(4-Carboxyphenyl)-1H-pyrazole structure
|
Common Name | 3-(4-Carboxyphenyl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 208511-67-5 | Molecular Weight | 188.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 469.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 237.8±24.0 °C | |
| Name | 4-(1H-pyrazol-5-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.6±28.0 °C at 760 mmHg |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.183 |
| Flash Point | 237.8±24.0 °C |
| Exact Mass | 188.058578 |
| PSA | 65.98000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | RFJWCCHRWJSWGI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccn[nH]2)cc1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
|
~%
3-(4-Carboxyphe... CAS#:208511-67-5 |
| Literature: Tetrahedron Letters, , vol. 39, # 20 p. 3287 - 3290 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(1H-Pyrazol-5-yl)benzoic acid |
| Benzoic acid, 4-(1H-pyrazol-3-yl)- |
| 4-pyrazol-3-ylbenzoic acid |
| 3-(4-Carboxyphenyl)-1H-pyrazole |
| 4-(1H-Pyrazol-3-yl)benzoic acid |