Epothilone F structure
|
Common Name | Epothilone F | ||
|---|---|---|---|---|
| CAS Number | 208518-52-9 | Molecular Weight | 523.68200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H41NO7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Epothilone FEpothilone F is a Microtubule/Tubulin-stabilizing agent with anti-tumor activity. Epothilone F inhibits the proliferation of breast cancer cells, non-small cell lung cancer cells, drug-resistant ovarian cancer cells[1]. |
| Name | Epothilone F |
|---|---|
| Synonym | More Synonyms |
| Description | Epothilone F is a Microtubule/Tubulin-stabilizing agent with anti-tumor activity. Epothilone F inhibits the proliferation of breast cancer cells, non-small cell lung cancer cells, drug-resistant ovarian cancer cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H41NO7S |
|---|---|
| Molecular Weight | 523.68200 |
| Exact Mass | 523.26000 |
| PSA | 157.72000 |
| LogP | 3.66140 |
| InChIKey | UKIMCRYGLFQEOE-RGJAOAFDSA-N |
| SMILES | CC(=Cc1csc(CO)n1)C1CC2OC2(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O1 |
| epothilone F |
| (1S,3S(E),7S,10R,11S,12S,16R)-7,11-dihydroxy-3-[2-(2-hydroxymethyl-thiazol-4-yl)-1-methyl-vinyl]-8,8,10,12,16-pentamethyl-4,17-dioxa-bicyclo[14.1.0]heptadecane-5,9-dione |
| (1S,3S,7S,10R,11S,12S,16R)-7,11-Dihydroxy-3-[(E)-2-(2-hydroxymethyl-thiazol-4-yl)-1-methyl-vinyl]-8,8,10,12,16-pentamethyl-4,17-dioxa-bicyclo[14.1.0]heptadecane-5,9-dione |