(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-ynoic acid structure
|
Common Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-ynoic acid | ||
|---|---|---|---|---|
| CAS Number | 208522-16-1 | Molecular Weight | 227.25700 | |
| Density | 1.129g/cm3 | Boiling Point | 380.3ºC at 760 mmHg | |
| Molecular Formula | C11H17NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 183.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-ynoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 380.3ºC at 760 mmHg |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.25700 |
| Flash Point | 183.8ºC |
| Exact Mass | 227.11600 |
| PSA | 79.12000 |
| LogP | 1.58210 |
| Vapour Pressure | 7.74E-07mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | DPHIBCOGEUVKGB-QMMMGPOBSA-N |
| SMILES | C#CCCC(NC(=O)OC(C)(C)C)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | NONH for all modes of transport |
| HS Code | 2924199090 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-L-homopropargylglycine |
| Boc-Hpg-OH |
| Boc-L-homopropargyl-Gly-OH |