(S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH structure
|
Common Name | (S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 2086301-47-3 | Molecular Weight | 754.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H58N6O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH(S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH (VH032-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH) is a E3 ligase ligand-linker conjugate that contains on one end a VHL ligand. (S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH is used in PROTAC technology[1]. |
| Name | (S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH |
|---|
| Description | (S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH (VH032-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH) is a E3 ligase ligand-linker conjugate that contains on one end a VHL ligand. (S,R,S)-AHPC-Boc-trans-3-aminocyclobutanol-Pip-CH2COOH is used in PROTAC technology[1]. |
|---|---|
| Related Catalog | |
| Target |
VHL |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C39H58N6O7S |
|---|---|
| Molecular Weight | 754.98 |
| InChIKey | MBBHQLTUHKETEL-WQULMBDRSA-N |
| SMILES | Cc1ncsc1-c1ccc(C(C)NC(=O)C2CC(O)CN2C(=O)C(NC(=O)CN2CCC(OC3CC(NC(=O)OC(C)(C)C)C3)CC2)C(C)(C)C)cc1 |