5-Nitroindolin-2-one structure
|
Common Name | 5-Nitroindolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 20870-79-5 | Molecular Weight | 178.145 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 411.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O3 | Melting Point | 233-236ºC | |
| MSDS | Chinese USA | Flash Point | 202.6±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Nitrooxindole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 411.4±45.0 °C at 760 mmHg |
| Melting Point | 233-236ºC |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.145 |
| Flash Point | 202.6±28.7 °C |
| Exact Mass | 178.037842 |
| PSA | 74.92000 |
| LogP | 1.73 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | JQCGHRDKVZPCRO-UHFFFAOYSA-N |
| SMILES | O=C1Cc2cc([N+](=O)[O-])ccc2N1 |
| Storage condition | Keep Cold |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933790090 |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|
Synthesis and biological evaluation of new pyridone-annelated isoindigos as anti-proliferative agents.
Molecules 19(9) , 13076-92, (2014) A selected set of substituted pyridone-annelated isoindigos 3a-f has been synthesized via interaction of 5- and 6-substituted oxindoles 2a-f with 6-ethyl-1,2,9-trioxopyrrolo[3,2-f]quinoline-8-carboxyl... |
| 5-Nitroindolin-2-one |
| 2H-Indol-2-one, 1,3-dihydro-5-nitro- |
| 5-NITROOXINDOLE |
| 5-Nitro-1,3-dihydro-2H-indol-2-one |
| 5-nitro-1,3-dihydroindol-2-one |
| MFCD00456999 |