6-benzyloxy-2-nitrotoluene structure
|
Common Name | 6-benzyloxy-2-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 20876-37-3 | Molecular Weight | 243.258 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C14H13NO3 | Melting Point | 60-63 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 165.2±25.7 °C | |
| Name | 2-methyl-1-nitro-3-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.2±27.0 °C at 760 mmHg |
| Melting Point | 60-63 °C(lit.) |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.258 |
| Flash Point | 165.2±25.7 °C |
| Exact Mass | 243.089539 |
| PSA | 55.05000 |
| LogP | 4.28 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | PBSZHNXXFIYDBU-UHFFFAOYSA-N |
| SMILES | Cc1c(OCc2ccccc2)cccc1[N+](=O)[O-] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
|
~98%
6-benzyloxy-2-n... CAS#:20876-37-3 |
| Literature: Seike, Hisayuki; Matsugi, Takeshi; Shimazaki, Atsushi Patent: US2009/12123 A1, 2009 ; Location in patent: Page/Page column 9-10 ; |
|
~99%
6-benzyloxy-2-n... CAS#:20876-37-3 |
| Literature: Ube Industries, Ltd.; SANTEN PHARMACEUTICAL CO., LTD. Patent: EP1679308 A1, 2006 ; Location in patent: Page/Page column 42 ; EP 1679308 A1 |
|
~94%
6-benzyloxy-2-n... CAS#:20876-37-3 |
| Literature: Brenneisen; Borner; Peter-Oesch; Schlunegger Archiv der Pharmazie, 1988 , vol. 321, # 8 p. 487 - 489 |
|
~%
6-benzyloxy-2-n... CAS#:20876-37-3 |
| Literature: Tetrahedron, , vol. 24, p. 6093 - 6109 |
|
~%
6-benzyloxy-2-n... CAS#:20876-37-3 |
| Literature: Helvetica Chimica Acta, , vol. 38, p. 1452,1469 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 6-benzyloxy-2-nitrotoluene |
| Benzene, 2-methyl-1-nitro-3-(phenylmethoxy)- |
| 2-(Benzyloxy)-6-nitrotoluene |
| 2-nitro-6-benzyloxytoluene |
| 2-methyl-1-nitro-3-(phenylmethoxy)benzene |
| 1-(Benzyloxy)-2-methyl-3-nitrobenzene |
| Benzyl 2-methyl-3-nitrophenyl ether |
| MFCD00100652 |
| 2-benzyloxy-6-nitrotoluene |
| 6-Nitro-2-benzyloxy-toluol |
| WNR B1 CO1R |
| 1-Benzyloxy-2-methyl-3-nitrobenzene |